C14H25N — CID 72588400
N-methyl-4-(2,6,6-trimethylcyclohex-2-en-1-yl)but-3-en-2-amine (PubChem CID 72588400) has the molecular formula C14H25N and a molecular weight of 207.36 g/mol. Its IUPAC name is N-methyl-4-(2,6,6-trimethylcyclohex-2-en-1-yl)but-3-en-2-amine.
| Compound Name | N-methyl-4-(2,6,6-trimethylcyclohex-2-en-1-yl)but-3-en-2-amine |
|---|---|
| PubChem CID | 72588400 |
| Molecular Formula | C14H25N |
| Molecular Weight | 207.36 g/mol |
| Exact Mass | 207.20 |
| IUPAC Name | N-methyl-4-(2,6,6-trimethylcyclohex-2-en-1-yl)but-3-en-2-amine |
| SMILES | CNC(C)C=CC1C(C)=CCCC1(C)C |
| InChI | InChI=1S/C14H25N/c1-11-7-6-10-14(3,4)13(11)9-8-12(2)15-5/h7-9,12-13,15H,6,10H2,1-5H3 |
| InChIKey | VOBIJSIRWXDYJE-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.36 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|