C19H23N3O4S — CID 7259049
[(2R)-1-(4-morpholin-4-ylanilino)-1-oxopropan-2-yl] 2,4-dimethyl-1,3-thiazole-5-carboxylate (PubChem CID 7259049) has the molecular formula C19H23N3O4S and a molecular weight of 389.48 g/mol. Its IUPAC name is [(2R)-1-(4-morpholin-4-ylanilino)-1-oxopropan-2-yl] 2,4-dimethyl-1,3-thiazole-5-carboxylate.
| Compound Name | [(2R)-1-(4-morpholin-4-ylanilino)-1-oxopropan-2-yl] 2,4-dimethyl-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 7259049 |
| Molecular Formula | C19H23N3O4S |
| Molecular Weight | 389.48 g/mol |
| Exact Mass | 389.14 |
| IUPAC Name | [(2R)-1-(4-morpholin-4-ylanilino)-1-oxopropan-2-yl] 2,4-dimethyl-1,3-thiazole-5-carboxylate |
| SMILES | Cc1nc(C)c(C(=O)O[C@H](C)C(=O)Nc2ccc(N3CCOCC3)cc2)s1 |
| InChI | InChI=1S/C19H23N3O4S/c1-12-17(27-14(3)20-12)19(24)26-13(2)18(23)21-15-4-6-16(7-5-15)22-8-10-25-11-9-22/h4-7,13H,8-11H2,1-3H3,(H,21,23)/t13-/m1/s1 |
| InChIKey | MUVBCWZMBAIALK-CYBMUJFWSA-N |
| XLogP | 2.78 |
| TPSA | 80.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.48 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|