C23H28N2O4 — CID 29324450
[(2R)-1-(4-morpholin-4-ylanilino)-1-oxopropan-2-yl] 2,4,6-trimethylbenzoate (PubChem CID 29324450) has the molecular formula C23H28N2O4 and a molecular weight of 396.49 g/mol. Its IUPAC name is [(2R)-1-(4-morpholin-4-ylanilino)-1-oxopropan-2-yl] 2,4,6-trimethylbenzoate.
| Compound Name | [(2R)-1-(4-morpholin-4-ylanilino)-1-oxopropan-2-yl] 2,4,6-trimethylbenzoate |
|---|---|
| PubChem CID | 29324450 |
| Molecular Formula | C23H28N2O4 |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.20 |
| IUPAC Name | [(2R)-1-(4-morpholin-4-ylanilino)-1-oxopropan-2-yl] 2,4,6-trimethylbenzoate |
| SMILES | Cc1cc(C)c(C(=O)O[C@H](C)C(=O)Nc2ccc(N3CCOCC3)cc2)c(C)c1 |
| InChI | InChI=1S/C23H28N2O4/c1-15-13-16(2)21(17(3)14-15)23(27)29-18(4)22(26)24-19-5-7-20(8-6-19)25-9-11-28-12-10-25/h5-8,13-14,18H,9-12H2,1-4H3,(H,24,26)/t18-/m1/s1 |
| InChIKey | RSQGNCHAOLSCCI-GOSISDBHSA-N |
| XLogP | 3.63 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|