C20H20N2O3 — CID 18078089
[1-(4-cyanoanilino)-1-oxopropan-2-yl] 2,4,6-trimethylbenzoate (PubChem CID 18078089) has the molecular formula C20H20N2O3 and a molecular weight of 336.39 g/mol. Its IUPAC name is [1-(4-cyanoanilino)-1-oxopropan-2-yl] 2,4,6-trimethylbenzoate.
| Compound Name | [1-(4-cyanoanilino)-1-oxopropan-2-yl] 2,4,6-trimethylbenzoate |
|---|---|
| PubChem CID | 18078089 |
| Molecular Formula | C20H20N2O3 |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.15 |
| IUPAC Name | [1-(4-cyanoanilino)-1-oxopropan-2-yl] 2,4,6-trimethylbenzoate |
| SMILES | Cc1cc(C)c(C(=O)OC(C)C(=O)Nc2ccc(C#N)cc2)c(C)c1 |
| InChI | InChI=1S/C20H20N2O3/c1-12-9-13(2)18(14(3)10-12)20(24)25-15(4)19(23)22-17-7-5-16(11-21)6-8-17/h5-10,15H,1-4H3,(H,22,23) |
| InChIKey | KMSJEIVUEULPCI-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |