C19H18N2O3 — CID 8535194
[(2S)-1-(4-cyanoanilino)-1-oxopropan-2-yl] 2,5-dimethylbenzoate (PubChem CID 8535194) has the molecular formula C19H18N2O3 and a molecular weight of 322.36 g/mol. Its IUPAC name is [(2S)-1-(4-cyanoanilino)-1-oxopropan-2-yl] 2,5-dimethylbenzoate.
| Compound Name | [(2S)-1-(4-cyanoanilino)-1-oxopropan-2-yl] 2,5-dimethylbenzoate |
|---|---|
| PubChem CID | 8535194 |
| Molecular Formula | C19H18N2O3 |
| Molecular Weight | 322.36 g/mol |
| Exact Mass | 322.13 |
| IUPAC Name | [(2S)-1-(4-cyanoanilino)-1-oxopropan-2-yl] 2,5-dimethylbenzoate |
| SMILES | Cc1ccc(C)c(C(=O)O[C@@H](C)C(=O)Nc2ccc(C#N)cc2)c1 |
| InChI | InChI=1S/C19H18N2O3/c1-12-4-5-13(2)17(10-12)19(23)24-14(3)18(22)21-16-8-6-15(11-20)7-9-16/h4-10,14H,1-3H3,(H,21,22)/t14-/m0/s1 |
| InChIKey | PCDPPMNZXKWQNV-AWEZNQCLSA-N |
| XLogP | 3.36 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.36 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |