C24H24ClN3O3 — CID 72613261
ethyl 4-amino-6-[3-(4-chlorophenyl)prop-2-enoylamino]-2-propylquinoline-3-carboxylate (PubChem CID 72613261) has the molecular formula C24H24ClN3O3 and a molecular weight of 437.93 g/mol. Its IUPAC name is ethyl 4-amino-6-[3-(4-chlorophenyl)prop-2-enoylamino]-2-propylquinoline-3-carboxylate.
| Compound Name | ethyl 4-amino-6-[3-(4-chlorophenyl)prop-2-enoylamino]-2-propylquinoline-3-carboxylate |
|---|---|
| PubChem CID | 72613261 |
| Molecular Formula | C24H24ClN3O3 |
| Molecular Weight | 437.93 g/mol |
| Exact Mass | 437.15 |
| IUPAC Name | ethyl 4-amino-6-[3-(4-chlorophenyl)prop-2-enoylamino]-2-propylquinoline-3-carboxylate |
| SMILES | CCCc1nc2ccc(NC(=O)C=Cc3ccc(Cl)cc3)cc2c(N)c1C(=O)OCC |
| InChI | InChI=1S/C24H24ClN3O3/c1-3-5-20-22(24(30)31-4-2)23(26)18-14-17(11-12-19(18)28-20)27-21(29)13-8-15-6-9-16(25)10-7-15/h6-14H,3-5H2,1-2H3,(H2,26,28)(H,27,29) |
| InChIKey | JMOCFKKVOVGIDR-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 94.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.93 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|