C19H19N2O5S- — CID 7261460
(2S)-2-[[(E)-2-(furan-2-carbonylamino)-3-phenylprop-2-enoyl]amino]-4-methylsulfanylbutanoate (PubChem CID 7261460) has the molecular formula C19H19N2O5S- and a molecular weight of 387.44 g/mol. Its IUPAC name is (2S)-2-[[(E)-2-(furan-2-carbonylamino)-3-phenylprop-2-enoyl]amino]-4-methylsulfanylbutanoate.
| Compound Name | (2S)-2-[[(E)-2-(furan-2-carbonylamino)-3-phenylprop-2-enoyl]amino]-4-methylsulfanylbutanoate |
|---|---|
| PubChem CID | 7261460 |
| Molecular Formula | C19H19N2O5S- |
| Molecular Weight | 387.44 g/mol |
| Exact Mass | 387.10 |
| IUPAC Name | (2S)-2-[[(E)-2-(furan-2-carbonylamino)-3-phenylprop-2-enoyl]amino]-4-methylsulfanylbutanoate |
| SMILES | CSCC[C@H](NC(=O)/C(=C\c1ccccc1)NC(=O)c1ccco1)C(=O)[O-] |
| InChI | InChI=1S/C19H20N2O5S/c1-27-11-9-14(19(24)25)20-17(22)15(12-13-6-3-2-4-7-13)21-18(23)16-8-5-10-26-16/h2-8,10,12,14H,9,11H2,1H3,(H,20,22)(H,21,23)(H,24,25)/p-1/b15-12+/t14-/m0/s1 |
| InChIKey | WXUKQKKNPWUHJZ-YEQVNJDRSA-M |
| XLogP | 1.04 |
| TPSA | 111.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.44 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|