C21H20O9 — CID 72615939
7-[3,4-dihydroxy-5-(1-hydroxyethyl)oxolan-2-yl]oxy-5,6-dihydroxy-2-phenylchromen-4-one (PubChem CID 72615939) has the molecular formula C21H20O9 and a molecular weight of 416.38 g/mol. Its IUPAC name is 7-[3,4-dihydroxy-5-(1-hydroxyethyl)oxolan-2-yl]oxy-5,6-dihydroxy-2-phenylchromen-4-one.
| Compound Name | 7-[3,4-dihydroxy-5-(1-hydroxyethyl)oxolan-2-yl]oxy-5,6-dihydroxy-2-phenylchromen-4-one |
|---|---|
| PubChem CID | 72615939 |
| Molecular Formula | C21H20O9 |
| Molecular Weight | 416.38 g/mol |
| Exact Mass | 416.11 |
| IUPAC Name | 7-[3,4-dihydroxy-5-(1-hydroxyethyl)oxolan-2-yl]oxy-5,6-dihydroxy-2-phenylchromen-4-one |
| SMILES | CC(O)C1OC(Oc2cc3oc(-c4ccccc4)cc(=O)c3c(O)c2O)C(O)C1O |
| InChI | InChI=1S/C21H20O9/c1-9(22)20-18(26)19(27)21(30-20)29-14-8-13-15(17(25)16(14)24)11(23)7-12(28-13)10-5-3-2-4-6-10/h2-9,18-22,24-27H,1H3 |
| InChIKey | XHQNBUMWFVBMCJ-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 149.82 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.38 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|