C21H25N3O5 — CID 7261675
[2-[[(1R)-1-(3,4-dimethylphenyl)ethyl]amino]-2-oxoethyl] 4-(dimethylamino)-3-nitrobenzoate (PubChem CID 7261675) has the molecular formula C21H25N3O5 and a molecular weight of 399.45 g/mol. Its IUPAC name is [2-[[(1R)-1-(3,4-dimethylphenyl)ethyl]amino]-2-oxoethyl] 4-(dimethylamino)-3-nitrobenzoate.
| Compound Name | [2-[[(1R)-1-(3,4-dimethylphenyl)ethyl]amino]-2-oxoethyl] 4-(dimethylamino)-3-nitrobenzoate |
|---|---|
| PubChem CID | 7261675 |
| Molecular Formula | C21H25N3O5 |
| Molecular Weight | 399.45 g/mol |
| Exact Mass | 399.18 |
| IUPAC Name | [2-[[(1R)-1-(3,4-dimethylphenyl)ethyl]amino]-2-oxoethyl] 4-(dimethylamino)-3-nitrobenzoate |
| SMILES | Cc1ccc([C@@H](C)NC(=O)COC(=O)c2ccc(N(C)C)c([N+](=O)[O-])c2)cc1C |
| InChI | InChI=1S/C21H25N3O5/c1-13-6-7-16(10-14(13)2)15(3)22-20(25)12-29-21(26)17-8-9-18(23(4)5)19(11-17)24(27)28/h6-11,15H,12H2,1-5H3,(H,22,25)/t15-/m1/s1 |
| InChIKey | YWAMDUKBVJHKOS-OAHLLOKOSA-N |
| XLogP | 3.31 |
| TPSA | 101.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.45 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|