C27H31ClNO3S+ — CID 72631921
2-[2-(2-chloro-3-methylidenecyclohexen-1-yl)ethenyl]-1,1-dimethyl-3-[4-(trioxidanylsulfanyl)butyl]benzo[e]indol-3-ium (PubChem CID 72631921) has the molecular formula C27H31ClNO3S+ and a molecular weight of 485.07 g/mol. Its IUPAC name is 2-[2-(2-chloro-3-methylidenecyclohexen-1-yl)ethenyl]-1,1-dimethyl-3-[4-(trioxidanylsulfanyl)butyl]benzo[e]indol-3-ium.
| Compound Name | 2-[2-(2-chloro-3-methylidenecyclohexen-1-yl)ethenyl]-1,1-dimethyl-3-[4-(trioxidanylsulfanyl)butyl]benzo[e]indol-3-ium |
|---|---|
| PubChem CID | 72631921 |
| Molecular Formula | C27H31ClNO3S+ |
| Molecular Weight | 485.07 g/mol |
| Exact Mass | 484.17 |
| IUPAC Name | 2-[2-(2-chloro-3-methylidenecyclohexen-1-yl)ethenyl]-1,1-dimethyl-3-[4-(trioxidanylsulfanyl)butyl]benzo[e]indol-3-ium |
| SMILES | C=C1CCCC(C=CC2=[N+](CCCCSOOO)c3ccc4ccccc4c3C2(C)C)=C1Cl |
| InChI | InChI=1S/C27H30ClNO3S/c1-19-9-8-11-21(26(19)28)14-16-24-27(2,3)25-22-12-5-4-10-20(22)13-15-23(25)29(24)17-6-7-18-33-32-31-30/h4-5,10,12-16H,1,6-9,11,17-18H2,2-3H3/p+1 |
| InChIKey | XBHGMZWBRMSQKA-UHFFFAOYSA-O |
| XLogP | 7.85 |
| TPSA | 41.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.07 |
| LogP ≤ 5 | 7.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|