C11H9ClNO3- — CID 7263713
(5R)-3-(2-chlorophenyl)-5-methyl-4H-1,2-oxazole-5-carboxylate (PubChem CID 7263713) has the molecular formula C11H9ClNO3- and a molecular weight of 238.65 g/mol. Its IUPAC name is (5R)-3-(2-chlorophenyl)-5-methyl-4H-1,2-oxazole-5-carboxylate.
| Compound Name | (5R)-3-(2-chlorophenyl)-5-methyl-4H-1,2-oxazole-5-carboxylate |
|---|---|
| PubChem CID | 7263713 |
| Molecular Formula | C11H9ClNO3- |
| Molecular Weight | 238.65 g/mol |
| Exact Mass | 238.03 |
| IUPAC Name | (5R)-3-(2-chlorophenyl)-5-methyl-4H-1,2-oxazole-5-carboxylate |
| SMILES | C[C@]1(C(=O)[O-])CC(c2ccccc2Cl)=NO1 |
| InChI | InChI=1S/C11H10ClNO3/c1-11(10(14)15)6-9(13-16-11)7-4-2-3-5-8(7)12/h2-5H,6H2,1H3,(H,14,15)/p-1/t11-/m1/s1 |
| InChIKey | ZRRIBPPHPPYNFM-LLVKDONJSA-M |
| XLogP | 0.97 |
| TPSA | 61.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.65 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |