C26H22N2O5 — CID 72638050
methyl 4-(3,5-dimethoxyphenyl)-2-(2-fluoren-9-ylidenehydrazinyl)-4-oxobut-2-enoate (PubChem CID 72638050) has the molecular formula C26H22N2O5 and a molecular weight of 442.47 g/mol. Its IUPAC name is methyl 4-(3,5-dimethoxyphenyl)-2-(2-fluoren-9-ylidenehydrazinyl)-4-oxobut-2-enoate.
| Compound Name | methyl 4-(3,5-dimethoxyphenyl)-2-(2-fluoren-9-ylidenehydrazinyl)-4-oxobut-2-enoate |
|---|---|
| PubChem CID | 72638050 |
| Molecular Formula | C26H22N2O5 |
| Molecular Weight | 442.47 g/mol |
| Exact Mass | 442.15 |
| IUPAC Name | methyl 4-(3,5-dimethoxyphenyl)-2-(2-fluoren-9-ylidenehydrazinyl)-4-oxobut-2-enoate |
| SMILES | COC(=O)C(=CC(=O)c1cc(OC)cc(OC)c1)NN=C1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C26H22N2O5/c1-31-17-12-16(13-18(14-17)32-2)24(29)15-23(26(30)33-3)27-28-25-21-10-6-4-8-19(21)20-9-5-7-11-22(20)25/h4-15,27H,1-3H3 |
| InChIKey | QMTZQLYBOORRLV-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 86.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.47 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|