C11H15N3O3 — CID 121221771
[(E)-1-(3,5-dimethoxyphenyl)ethylideneamino]urea (PubChem CID 121221771) has the molecular formula C11H15N3O3 and a molecular weight of 237.26 g/mol. Its IUPAC name is [(E)-1-(3,5-dimethoxyphenyl)ethylideneamino]urea.
| Compound Name | [(E)-1-(3,5-dimethoxyphenyl)ethylideneamino]urea |
|---|---|
| PubChem CID | 121221771 |
| Molecular Formula | C11H15N3O3 |
| Molecular Weight | 237.26 g/mol |
| Exact Mass | 237.11 |
| IUPAC Name | [(E)-1-(3,5-dimethoxyphenyl)ethylideneamino]urea |
| SMILES | COc1cc(OC)cc(/C(C)=N/NC(N)=O)c1 |
| InChI | InChI=1S/C11H15N3O3/c1-7(13-14-11(12)15)8-4-9(16-2)6-10(5-8)17-3/h4-6H,1-3H3,(H3,12,14,15)/b13-7+ |
| InChIKey | JJKDTWXQRFMRQQ-NTUHNPAUSA-N |
| XLogP | 1.10 |
| TPSA | 85.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.26 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|