C16H20N4O5 — CID 72641394
(2,5-dioxopyrrolidin-1-yl) N-[[(2-amino-3-phenylpropanoyl)-methylamino]methyl]carbamate (PubChem CID 72641394) has the molecular formula C16H20N4O5 and a molecular weight of 348.36 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) N-[[(2-amino-3-phenylpropanoyl)-methylamino]methyl]carbamate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) N-[[(2-amino-3-phenylpropanoyl)-methylamino]methyl]carbamate |
|---|---|
| PubChem CID | 72641394 |
| Molecular Formula | C16H20N4O5 |
| Molecular Weight | 348.36 g/mol |
| Exact Mass | 348.14 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) N-[[(2-amino-3-phenylpropanoyl)-methylamino]methyl]carbamate |
| SMILES | CN(CNC(=O)ON1C(=O)CCC1=O)C(=O)C(N)Cc1ccccc1 |
| InChI | InChI=1S/C16H20N4O5/c1-19(15(23)12(17)9-11-5-3-2-4-6-11)10-18-16(24)25-20-13(21)7-8-14(20)22/h2-6,12H,7-10,17H2,1H3,(H,18,24) |
| InChIKey | VCGOTFICKOMIJR-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 122.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.36 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|