C17H18OS — CID 72648019
[4-[4-(4,5-dimethylthiophen-2-yl)buta-1,3-dienyl]phenyl]methanol (PubChem CID 72648019) has the molecular formula C17H18OS and a molecular weight of 270.40 g/mol. Its IUPAC name is [4-[4-(4,5-dimethylthiophen-2-yl)buta-1,3-dienyl]phenyl]methanol.
| Compound Name | [4-[4-(4,5-dimethylthiophen-2-yl)buta-1,3-dienyl]phenyl]methanol |
|---|---|
| PubChem CID | 72648019 |
| Molecular Formula | C17H18OS |
| Molecular Weight | 270.40 g/mol |
| Exact Mass | 270.11 |
| IUPAC Name | [4-[4-(4,5-dimethylthiophen-2-yl)buta-1,3-dienyl]phenyl]methanol |
| SMILES | Cc1cc(C=CC=Cc2ccc(CO)cc2)sc1C |
| InChI | InChI=1S/C17H18OS/c1-13-11-17(19-14(13)2)6-4-3-5-15-7-9-16(12-18)10-8-15/h3-11,18H,12H2,1-2H3 |
| InChIKey | XPDHFUXGQGJTCP-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.40 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|