C27H40O — CID 72651548
10,13-dimethyl-17-(6-methylhepta-4,6-dien-2-yl)-2,3,4,7,8,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-ol (PubChem CID 72651548) has the molecular formula C27H40O and a molecular weight of 380.62 g/mol. Its IUPAC name is 10,13-dimethyl-17-(6-methylhepta-4,6-dien-2-yl)-2,3,4,7,8,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-ol.
| Compound Name | 10,13-dimethyl-17-(6-methylhepta-4,6-dien-2-yl)-2,3,4,7,8,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 72651548 |
| Molecular Formula | C27H40O |
| Molecular Weight | 380.62 g/mol |
| Exact Mass | 380.31 |
| IUPAC Name | 10,13-dimethyl-17-(6-methylhepta-4,6-dien-2-yl)-2,3,4,7,8,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-ol |
| SMILES | C=C(C)C=CCC(C)C1CCC2C3CC=C4CC(O)CCC4(C)C3=CCC12C |
| InChI | InChI=1S/C27H40O/c1-18(2)7-6-8-19(3)23-11-12-24-22-10-9-20-17-21(28)13-15-26(20,4)25(22)14-16-27(23,24)5/h6-7,9,14,19,21-24,28H,1,8,10-13,15-17H2,2-5H3 |
| InChIKey | RNZVCADRRUMYSO-UHFFFAOYSA-N |
| XLogP | 7.00 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.62 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|