C23H20N4O4S2 — CID 72654889
4-[5-[[2-(4-methylanilino)-4-oxopyrido[1,2-a]pyrimidin-3-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoic acid (PubChem CID 72654889) has the molecular formula C23H20N4O4S2 and a molecular weight of 480.57 g/mol. Its IUPAC name is 4-[5-[[2-(4-methylanilino)-4-oxopyrido[1,2-a]pyrimidin-3-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoic acid.
| Compound Name | 4-[5-[[2-(4-methylanilino)-4-oxopyrido[1,2-a]pyrimidin-3-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoic acid |
|---|---|
| PubChem CID | 72654889 |
| Molecular Formula | C23H20N4O4S2 |
| Molecular Weight | 480.57 g/mol |
| Exact Mass | 480.09 |
| IUPAC Name | 4-[5-[[2-(4-methylanilino)-4-oxopyrido[1,2-a]pyrimidin-3-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoic acid |
| SMILES | Cc1ccc(Nc2nc3ccccn3c(=O)c2C=C2SC(=S)N(CCCC(=O)O)C2=O)cc1 |
| InChI | InChI=1S/C23H20N4O4S2/c1-14-7-9-15(10-8-14)24-20-16(21(30)26-11-3-2-5-18(26)25-20)13-17-22(31)27(23(32)33-17)12-4-6-19(28)29/h2-3,5,7-11,13,24H,4,6,12H2,1H3,(H,28,29) |
| InChIKey | IFJYBODGYQXITN-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 104.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.57 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|