C24H18N6O4S3 — CID 91057343
4-[4-oxo-5-[[4-oxo-2-[(5-phenyl-2H-triazol-4-yl)sulfanyl]pyrido[1,2-a]pyrimidin-3-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoic acid (PubChem CID 91057343) has the molecular formula C24H18N6O4S3 and a molecular weight of 550.65 g/mol. Its IUPAC name is 4-[4-oxo-5-[[4-oxo-2-[(5-phenyl-2H-triazol-4-yl)sulfanyl]pyrido[1,2-a]pyrimidin-3-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoic acid.
| Compound Name | 4-[4-oxo-5-[[4-oxo-2-[(5-phenyl-2H-triazol-4-yl)sulfanyl]pyrido[1,2-a]pyrimidin-3-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoic acid |
|---|---|
| PubChem CID | 91057343 |
| Molecular Formula | C24H18N6O4S3 |
| Molecular Weight | 550.65 g/mol |
| Exact Mass | 550.06 |
| IUPAC Name | 4-[4-oxo-5-[[4-oxo-2-[(5-phenyl-2H-triazol-4-yl)sulfanyl]pyrido[1,2-a]pyrimidin-3-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoic acid |
| SMILES | O=C(O)CCCN1C(=O)C(=Cc2c(Sc3n[nH]nc3-c3ccccc3)nc3ccccn3c2=O)SC1=S |
| InChI | InChI=1S/C24H18N6O4S3/c31-18(32)10-6-12-30-23(34)16(36-24(30)35)13-15-20(25-17-9-4-5-11-29(17)22(15)33)37-21-19(26-28-27-21)14-7-2-1-3-8-14/h1-5,7-9,11,13H,6,10,12H2,(H,31,32)(H,26,27,28) |
| InChIKey | BVLPAHQTCMZZEU-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 133.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.65 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|