C15H11F2NO5S2 — CID 72655398
4-[5-[(2,2-difluoro-1,3-benzodioxol-4-yl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoic acid (PubChem CID 72655398) has the molecular formula C15H11F2NO5S2 and a molecular weight of 387.39 g/mol. Its IUPAC name is 4-[5-[(2,2-difluoro-1,3-benzodioxol-4-yl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoic acid.
| Compound Name | 4-[5-[(2,2-difluoro-1,3-benzodioxol-4-yl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoic acid |
|---|---|
| PubChem CID | 72655398 |
| Molecular Formula | C15H11F2NO5S2 |
| Molecular Weight | 387.39 g/mol |
| Exact Mass | 387.00 |
| IUPAC Name | 4-[5-[(2,2-difluoro-1,3-benzodioxol-4-yl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoic acid |
| SMILES | O=C(O)CCCN1C(=O)C(=Cc2cccc3c2OC(F)(F)O3)SC1=S |
| InChI | InChI=1S/C15H11F2NO5S2/c16-15(17)22-9-4-1-3-8(12(9)23-15)7-10-13(21)18(14(24)25-10)6-2-5-11(19)20/h1,3-4,7H,2,5-6H2,(H,19,20) |
| InChIKey | DBSWBYHFWTZBNB-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.39 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|