C31H28N4 — CID 72655979
3-N-(2,5-diphenylpyrrol-1-yl)-2-N-(2-methyl-5-phenylpyrrol-1-yl)butane-2,3-diimine (PubChem CID 72655979) has the molecular formula C31H28N4 and a molecular weight of 456.59 g/mol. Its IUPAC name is 3-N-(2,5-diphenylpyrrol-1-yl)-2-N-(2-methyl-5-phenylpyrrol-1-yl)butane-2,3-diimine.
| Compound Name | 3-N-(2,5-diphenylpyrrol-1-yl)-2-N-(2-methyl-5-phenylpyrrol-1-yl)butane-2,3-diimine |
|---|---|
| PubChem CID | 72655979 |
| Molecular Formula | C31H28N4 |
| Molecular Weight | 456.59 g/mol |
| Exact Mass | 456.23 |
| IUPAC Name | 3-N-(2,5-diphenylpyrrol-1-yl)-2-N-(2-methyl-5-phenylpyrrol-1-yl)butane-2,3-diimine |
| SMILES | CC(=Nn1c(C)ccc1-c1ccccc1)C(C)=Nn1c(-c2ccccc2)ccc1-c1ccccc1 |
| InChI | InChI=1S/C31H28N4/c1-23-19-20-29(26-13-7-4-8-14-26)34(23)32-24(2)25(3)33-35-30(27-15-9-5-10-16-27)21-22-31(35)28-17-11-6-12-18-28/h4-22H,1-3H3 |
| InChIKey | OQHTZBQYPPSVLS-UHFFFAOYSA-N |
| XLogP | 7.75 |
| TPSA | 34.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.59 |
| LogP ≤ 5 | 7.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|