C23H20Cl2N2 — CID 177419277
1-[3,5-dichloro-4-(2,5-dimethylpyrrol-1-yl)phenyl]-2-methyl-5-phenylpyrrole (PubChem CID 177419277) has the molecular formula C23H20Cl2N2 and a molecular weight of 395.33 g/mol. Its IUPAC name is 1-[3,5-dichloro-4-(2,5-dimethylpyrrol-1-yl)phenyl]-2-methyl-5-phenylpyrrole.
| Compound Name | 1-[3,5-dichloro-4-(2,5-dimethylpyrrol-1-yl)phenyl]-2-methyl-5-phenylpyrrole |
|---|---|
| PubChem CID | 177419277 |
| Molecular Formula | C23H20Cl2N2 |
| Molecular Weight | 395.33 g/mol |
| Exact Mass | 394.10 |
| IUPAC Name | 1-[3,5-dichloro-4-(2,5-dimethylpyrrol-1-yl)phenyl]-2-methyl-5-phenylpyrrole |
| SMILES | Cc1ccc(C)n1-c1c(Cl)cc(-n2c(C)ccc2-c2ccccc2)cc1Cl |
| InChI | InChI=1S/C23H20Cl2N2/c1-15-9-10-16(2)26(15)23-20(24)13-19(14-21(23)25)27-17(3)11-12-22(27)18-7-5-4-6-8-18/h4-14H,1-3H3 |
| InChIKey | PBKOQXROBMIOFJ-UHFFFAOYSA-N |
| XLogP | 7.17 |
| TPSA | 9.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.33 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'} |
|---|