C21H24N2 — CID 4763704
N,N-diethyl-4-(2-methyl-5-phenylpyrrol-1-yl)aniline (PubChem CID 4763704) has the molecular formula C21H24N2 and a molecular weight of 304.44 g/mol. Its IUPAC name is N,N-diethyl-4-(2-methyl-5-phenylpyrrol-1-yl)aniline.
| Compound Name | N,N-diethyl-4-(2-methyl-5-phenylpyrrol-1-yl)aniline |
|---|---|
| PubChem CID | 4763704 |
| Molecular Formula | C21H24N2 |
| Molecular Weight | 304.44 g/mol |
| Exact Mass | 304.19 |
| IUPAC Name | N,N-diethyl-4-(2-methyl-5-phenylpyrrol-1-yl)aniline |
| SMILES | CCN(CC)c1ccc(-n2c(C)ccc2-c2ccccc2)cc1 |
| InChI | InChI=1S/C21H24N2/c1-4-22(5-2)19-12-14-20(15-13-19)23-17(3)11-16-21(23)18-9-7-6-8-10-18/h6-16H,4-5H2,1-3H3 |
| InChIKey | IJVAHQHAOBUSFJ-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 8.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.44 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'} |
|---|