C43H36N4O2 — CID 72655982
ethyl 1-[3-(2,5-diphenylpyrrol-1-yl)iminobutan-2-ylideneamino]-5-naphthalen-1-yl-2-phenylpyrrole-3-carboxylate (PubChem CID 72655982) has the molecular formula C43H36N4O2 and a molecular weight of 640.79 g/mol. Its IUPAC name is ethyl 1-[3-(2,5-diphenylpyrrol-1-yl)iminobutan-2-ylideneamino]-5-naphthalen-1-yl-2-phenylpyrrole-3-carboxylate.
| Compound Name | ethyl 1-[3-(2,5-diphenylpyrrol-1-yl)iminobutan-2-ylideneamino]-5-naphthalen-1-yl-2-phenylpyrrole-3-carboxylate |
|---|---|
| PubChem CID | 72655982 |
| Molecular Formula | C43H36N4O2 |
| Molecular Weight | 640.79 g/mol |
| Exact Mass | 640.28 |
| IUPAC Name | ethyl 1-[3-(2,5-diphenylpyrrol-1-yl)iminobutan-2-ylideneamino]-5-naphthalen-1-yl-2-phenylpyrrole-3-carboxylate |
| SMILES | CCOC(=O)c1cc(-c2cccc3ccccc23)n(N=C(C)C(C)=Nn2c(-c3ccccc3)ccc2-c2ccccc2)c1-c1ccccc1 |
| InChI | InChI=1S/C43H36N4O2/c1-4-49-43(48)38-29-41(37-26-16-24-32-17-14-15-25-36(32)37)47(42(38)35-22-12-7-13-23-35)45-31(3)30(2)44-46-39(33-18-8-5-9-19-33)27-28-40(46)34-20-10-6-11-21-34/h5-29H,4H2,1-3H3 |
| InChIKey | KJKWTPBIQASVPH-UHFFFAOYSA-N |
| XLogP | 10.44 |
| TPSA | 60.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.79 |
| LogP ≤ 5 | 10.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|