C17H17ClN2O4 — CID 72661502
3-[(6-chloro-5-methoxypyridine-2-carbonyl)amino]-3-(2-methylphenyl)propanoic acid (PubChem CID 72661502) has the molecular formula C17H17ClN2O4 and a molecular weight of 348.79 g/mol. Its IUPAC name is 3-[(6-chloro-5-methoxypyridine-2-carbonyl)amino]-3-(2-methylphenyl)propanoic acid.
| Compound Name | 3-[(6-chloro-5-methoxypyridine-2-carbonyl)amino]-3-(2-methylphenyl)propanoic acid |
|---|---|
| PubChem CID | 72661502 |
| Molecular Formula | C17H17ClN2O4 |
| Molecular Weight | 348.79 g/mol |
| Exact Mass | 348.09 |
| IUPAC Name | 3-[(6-chloro-5-methoxypyridine-2-carbonyl)amino]-3-(2-methylphenyl)propanoic acid |
| SMILES | COc1ccc(C(=O)NC(CC(=O)O)c2ccccc2C)nc1Cl |
| InChI | InChI=1S/C17H17ClN2O4/c1-10-5-3-4-6-11(10)13(9-15(21)22)20-17(23)12-7-8-14(24-2)16(18)19-12/h3-8,13H,9H2,1-2H3,(H,20,23)(H,21,22) |
| InChIKey | JZTHSNFKVKPCTI-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.79 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|