C28H24N2O3 — CID 90093169
(3S)-3-(2-methylphenyl)-3-[[6-(3-phenylphenyl)pyridine-2-carbonyl]amino]propanoic acid (PubChem CID 90093169) has the molecular formula C28H24N2O3 and a molecular weight of 436.51 g/mol. Its IUPAC name is (3S)-3-(2-methylphenyl)-3-[[6-(3-phenylphenyl)pyridine-2-carbonyl]amino]propanoic acid.
| Compound Name | (3S)-3-(2-methylphenyl)-3-[[6-(3-phenylphenyl)pyridine-2-carbonyl]amino]propanoic acid |
|---|---|
| PubChem CID | 90093169 |
| Molecular Formula | C28H24N2O3 |
| Molecular Weight | 436.51 g/mol |
| Exact Mass | 436.18 |
| IUPAC Name | (3S)-3-(2-methylphenyl)-3-[[6-(3-phenylphenyl)pyridine-2-carbonyl]amino]propanoic acid |
| SMILES | Cc1ccccc1[C@H](CC(=O)O)NC(=O)c1cccc(-c2cccc(-c3ccccc3)c2)n1 |
| InChI | InChI=1S/C28H24N2O3/c1-19-9-5-6-14-23(19)26(18-27(31)32)30-28(33)25-16-8-15-24(29-25)22-13-7-12-21(17-22)20-10-3-2-4-11-20/h2-17,26H,18H2,1H3,(H,30,33)(H,31,32)/t26-/m0/s1 |
| InChIKey | HPCLUPWEYNHVBG-SANMLTNESA-N |
| XLogP | 5.67 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.51 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |