C27H25N3O3 — CID 71269586
3-[(1-benzyl-5-phenylpyrazole-3-carbonyl)amino]-3-(2-methylphenyl)propanoic acid (PubChem CID 71269586) has the molecular formula C27H25N3O3 and a molecular weight of 439.52 g/mol. Its IUPAC name is 3-[(1-benzyl-5-phenylpyrazole-3-carbonyl)amino]-3-(2-methylphenyl)propanoic acid.
| Compound Name | 3-[(1-benzyl-5-phenylpyrazole-3-carbonyl)amino]-3-(2-methylphenyl)propanoic acid |
|---|---|
| PubChem CID | 71269586 |
| Molecular Formula | C27H25N3O3 |
| Molecular Weight | 439.52 g/mol |
| Exact Mass | 439.19 |
| IUPAC Name | 3-[(1-benzyl-5-phenylpyrazole-3-carbonyl)amino]-3-(2-methylphenyl)propanoic acid |
| SMILES | Cc1ccccc1C(CC(=O)O)NC(=O)c1cc(-c2ccccc2)n(Cc2ccccc2)n1 |
| InChI | InChI=1S/C27H25N3O3/c1-19-10-8-9-15-22(19)23(17-26(31)32)28-27(33)24-16-25(21-13-6-3-7-14-21)30(29-24)18-20-11-4-2-5-12-20/h2-16,23H,17-18H2,1H3,(H,28,33)(H,31,32) |
| InChIKey | FLLXHPCZMPYHFZ-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.52 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |