C34H28N2O4 — CID 72663279
3-[2-methyl-4-(2-phenylethynyl)phenyl]-2-[2-(3,4,5-trimethoxyphenyl)ethenyl]quinazolin-4-one (PubChem CID 72663279) has the molecular formula C34H28N2O4 and a molecular weight of 528.61 g/mol. Its IUPAC name is 3-[2-methyl-4-(2-phenylethynyl)phenyl]-2-[2-(3,4,5-trimethoxyphenyl)ethenyl]quinazolin-4-one.
| Compound Name | 3-[2-methyl-4-(2-phenylethynyl)phenyl]-2-[2-(3,4,5-trimethoxyphenyl)ethenyl]quinazolin-4-one |
|---|---|
| PubChem CID | 72663279 |
| Molecular Formula | C34H28N2O4 |
| Molecular Weight | 528.61 g/mol |
| Exact Mass | 528.20 |
| IUPAC Name | 3-[2-methyl-4-(2-phenylethynyl)phenyl]-2-[2-(3,4,5-trimethoxyphenyl)ethenyl]quinazolin-4-one |
| SMILES | COc1cc(C=Cc2nc3ccccc3c(=O)n2-c2ccc(C#Cc3ccccc3)cc2C)cc(OC)c1OC |
| InChI | InChI=1S/C34H28N2O4/c1-23-20-25(15-14-24-10-6-5-7-11-24)16-18-29(23)36-32(35-28-13-9-8-12-27(28)34(36)37)19-17-26-21-30(38-2)33(40-4)31(22-26)39-3/h5-13,16-22H,1-4H3 |
| InChIKey | XZXTZWMCDWMUFR-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 62.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.61 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|