C44H52N2O2 — CID 72673158
4-[2-[7-[2-[4-(dimethylamino)phenyl]ethenyl]-9,10-dipentoxyanthracen-2-yl]ethenyl]-N,N-dimethylaniline (PubChem CID 72673158) has the molecular formula C44H52N2O2 and a molecular weight of 640.91 g/mol. Its IUPAC name is 4-[2-[7-[2-[4-(dimethylamino)phenyl]ethenyl]-9,10-dipentoxyanthracen-2-yl]ethenyl]-N,N-dimethylaniline.
| Compound Name | 4-[2-[7-[2-[4-(dimethylamino)phenyl]ethenyl]-9,10-dipentoxyanthracen-2-yl]ethenyl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 72673158 |
| Molecular Formula | C44H52N2O2 |
| Molecular Weight | 640.91 g/mol |
| Exact Mass | 640.40 |
| IUPAC Name | 4-[2-[7-[2-[4-(dimethylamino)phenyl]ethenyl]-9,10-dipentoxyanthracen-2-yl]ethenyl]-N,N-dimethylaniline |
| SMILES | CCCCCOc1c2ccc(C=Cc3ccc(N(C)C)cc3)cc2c(OCCCCC)c2cc(C=Cc3ccc(N(C)C)cc3)ccc12 |
| InChI | InChI=1S/C44H52N2O2/c1-7-9-11-29-47-43-39-27-21-35(15-13-33-17-23-37(24-18-33)45(3)4)31-41(39)44(48-30-12-10-8-2)42-32-36(22-28-40(42)43)16-14-34-19-25-38(26-20-34)46(5)6/h13-28,31-32H,7-12,29-30H2,1-6H3 |
| InChIKey | IPHRMLNADYOUNK-UHFFFAOYSA-N |
| XLogP | 11.60 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.91 |
| LogP ≤ 5 | 11.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|