C20H25FN2O2 — CID 72679887
N-[[4-(4-fluorophenyl)morpholin-3-yl]methyl]-1-(3-methoxyphenyl)ethanamine (PubChem CID 72679887) has the molecular formula C20H25FN2O2 and a molecular weight of 344.43 g/mol. Its IUPAC name is N-[[4-(4-fluorophenyl)morpholin-3-yl]methyl]-1-(3-methoxyphenyl)ethanamine.
| Compound Name | N-[[4-(4-fluorophenyl)morpholin-3-yl]methyl]-1-(3-methoxyphenyl)ethanamine |
|---|---|
| PubChem CID | 72679887 |
| Molecular Formula | C20H25FN2O2 |
| Molecular Weight | 344.43 g/mol |
| Exact Mass | 344.19 |
| IUPAC Name | N-[[4-(4-fluorophenyl)morpholin-3-yl]methyl]-1-(3-methoxyphenyl)ethanamine |
| SMILES | COc1cccc(C(C)NCC2COCCN2c2ccc(F)cc2)c1 |
| InChI | InChI=1S/C20H25FN2O2/c1-15(16-4-3-5-20(12-16)24-2)22-13-19-14-25-11-10-23(19)18-8-6-17(21)7-9-18/h3-9,12,15,19,22H,10-11,13-14H2,1-2H3 |
| InChIKey | HFGLAZYOORRQAL-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.43 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |