C25H26N2O4 — CID 72680316
3-[[2-[(1-naphthalen-1-ylethylamino)methyl]-5-oxomorpholin-4-yl]methyl]benzoic acid (PubChem CID 72680316) has the molecular formula C25H26N2O4 and a molecular weight of 418.49 g/mol. Its IUPAC name is 3-[[2-[(1-naphthalen-1-ylethylamino)methyl]-5-oxomorpholin-4-yl]methyl]benzoic acid.
| Compound Name | 3-[[2-[(1-naphthalen-1-ylethylamino)methyl]-5-oxomorpholin-4-yl]methyl]benzoic acid |
|---|---|
| PubChem CID | 72680316 |
| Molecular Formula | C25H26N2O4 |
| Molecular Weight | 418.49 g/mol |
| Exact Mass | 418.19 |
| IUPAC Name | 3-[[2-[(1-naphthalen-1-ylethylamino)methyl]-5-oxomorpholin-4-yl]methyl]benzoic acid |
| SMILES | CC(NCC1CN(Cc2cccc(C(=O)O)c2)C(=O)CO1)c1cccc2ccccc12 |
| InChI | InChI=1S/C25H26N2O4/c1-17(22-11-5-8-19-7-2-3-10-23(19)22)26-13-21-15-27(24(28)16-31-21)14-18-6-4-9-20(12-18)25(29)30/h2-12,17,21,26H,13-16H2,1H3,(H,29,30) |
| InChIKey | QOBPLQGXUHSVEC-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.49 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |