C27H33Cl2NO3 — CID 159774736
3-[[2-[(4S)-4-naphthalen-1-ylpentyl]morpholin-4-yl]methyl]benzoic acid;dihydrochloride (PubChem CID 159774736) has the molecular formula C27H33Cl2NO3 and a molecular weight of 490.47 g/mol. Its IUPAC name is 3-[[2-[(4S)-4-naphthalen-1-ylpentyl]morpholin-4-yl]methyl]benzoic acid;dihydrochloride.
| Compound Name | 3-[[2-[(4S)-4-naphthalen-1-ylpentyl]morpholin-4-yl]methyl]benzoic acid;dihydrochloride |
|---|---|
| PubChem CID | 159774736 |
| Molecular Formula | C27H33Cl2NO3 |
| Molecular Weight | 490.47 g/mol |
| Exact Mass | 489.18 |
| IUPAC Name | 3-[[2-[(4S)-4-naphthalen-1-ylpentyl]morpholin-4-yl]methyl]benzoic acid;dihydrochloride |
| SMILES | C[C@@H](CCCC1CN(Cc2cccc(C(=O)O)c2)CCO1)c1cccc2ccccc12.Cl.Cl |
| InChI | InChI=1S/C27H31NO3.2ClH/c1-20(25-14-6-10-22-9-2-3-13-26(22)25)7-4-12-24-19-28(15-16-31-24)18-21-8-5-11-23(17-21)27(29)30;;/h2-3,5-6,8-11,13-14,17,20,24H,4,7,12,15-16,18-19H2,1H3,(H,29,30);2*1H/t20-,24?;;/m0../s1 |
| InChIKey | NLQSKFVEBPJMIM-HGCMTXIOSA-N |
| XLogP | 6.56 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.47 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |