C27H32N2O3 — CID 122507072
methyl 4-[[2-[2-[[(1R)-1-naphthalen-1-ylethyl]amino]ethyl]morpholin-4-yl]methyl]benzoate (PubChem CID 122507072) has the molecular formula C27H32N2O3 and a molecular weight of 432.56 g/mol. Its IUPAC name is methyl 4-[[2-[2-[[(1R)-1-naphthalen-1-ylethyl]amino]ethyl]morpholin-4-yl]methyl]benzoate.
| Compound Name | methyl 4-[[2-[2-[[(1R)-1-naphthalen-1-ylethyl]amino]ethyl]morpholin-4-yl]methyl]benzoate |
|---|---|
| PubChem CID | 122507072 |
| Molecular Formula | C27H32N2O3 |
| Molecular Weight | 432.56 g/mol |
| Exact Mass | 432.24 |
| IUPAC Name | methyl 4-[[2-[2-[[(1R)-1-naphthalen-1-ylethyl]amino]ethyl]morpholin-4-yl]methyl]benzoate |
| SMILES | COC(=O)c1ccc(CN2CCOC(CCN[C@H](C)c3cccc4ccccc34)C2)cc1 |
| InChI | InChI=1S/C27H32N2O3/c1-20(25-9-5-7-22-6-3-4-8-26(22)25)28-15-14-24-19-29(16-17-32-24)18-21-10-12-23(13-11-21)27(30)31-2/h3-13,20,24,28H,14-19H2,1-2H3/t20-,24?/m1/s1 |
| InChIKey | KOJMPZPXKNMTQT-CGHJUBPDSA-N |
| XLogP | 4.57 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.56 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |