C28H32N2O4 — CID 68910564
(1R)-N-[[(3R)-1-benzylpyrrolidin-3-yl]methyl]-1-naphthalen-1-ylethanamine;(E)-but-2-enedioic acid (PubChem CID 68910564) has the molecular formula C28H32N2O4 and a molecular weight of 460.57 g/mol. Its IUPAC name is (1R)-N-[[(3R)-1-benzylpyrrolidin-3-yl]methyl]-1-naphthalen-1-ylethanamine;(E)-but-2-enedioic acid.
| Compound Name | (1R)-N-[[(3R)-1-benzylpyrrolidin-3-yl]methyl]-1-naphthalen-1-ylethanamine;(E)-but-2-enedioic acid |
|---|---|
| PubChem CID | 68910564 |
| Molecular Formula | C28H32N2O4 |
| Molecular Weight | 460.57 g/mol |
| Exact Mass | 460.24 |
| IUPAC Name | (1R)-N-[[(3R)-1-benzylpyrrolidin-3-yl]methyl]-1-naphthalen-1-ylethanamine;(E)-but-2-enedioic acid |
| SMILES | C[C@@H](NC[C@H]1CCN(Cc2ccccc2)C1)c1cccc2ccccc12.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C24H28N2.C4H4O4/c1-19(23-13-7-11-22-10-5-6-12-24(22)23)25-16-21-14-15-26(18-21)17-20-8-3-2-4-9-20;5-3(6)1-2-4(7)8/h2-13,19,21,25H,14-18H2,1H3;1-2H,(H,5,6)(H,7,8)/b;2-1+/t19-,21-;/m1./s1 |
| InChIKey | ZEDONONJHDLBPL-HYLJMZGCSA-N |
| XLogP | 4.72 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.57 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|