C16H17N3O2S2 — CID 72686315
2-cyano-N-(3-ethoxypropyl)-3-(2-thiophen-2-yl-1,3-thiazol-4-yl)prop-2-enamide (PubChem CID 72686315) has the molecular formula C16H17N3O2S2 and a molecular weight of 347.47 g/mol. Its IUPAC name is 2-cyano-N-(3-ethoxypropyl)-3-(2-thiophen-2-yl-1,3-thiazol-4-yl)prop-2-enamide.
| Compound Name | 2-cyano-N-(3-ethoxypropyl)-3-(2-thiophen-2-yl-1,3-thiazol-4-yl)prop-2-enamide |
|---|---|
| PubChem CID | 72686315 |
| Molecular Formula | C16H17N3O2S2 |
| Molecular Weight | 347.47 g/mol |
| Exact Mass | 347.08 |
| IUPAC Name | 2-cyano-N-(3-ethoxypropyl)-3-(2-thiophen-2-yl-1,3-thiazol-4-yl)prop-2-enamide |
| SMILES | CCOCCCNC(=O)C(C#N)=Cc1csc(-c2cccs2)n1 |
| InChI | InChI=1S/C16H17N3O2S2/c1-2-21-7-4-6-18-15(20)12(10-17)9-13-11-23-16(19-13)14-5-3-8-22-14/h3,5,8-9,11H,2,4,6-7H2,1H3,(H,18,20) |
| InChIKey | BMTVODJEXBAMPY-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 75.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.47 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|