C16H12F2N2O3 — CID 72687855
N-[(2,5-difluorophenyl)methyl]-3-(2-nitrophenyl)prop-2-enamide (PubChem CID 72687855) has the molecular formula C16H12F2N2O3 and a molecular weight of 318.28 g/mol. Its IUPAC name is N-[(2,5-difluorophenyl)methyl]-3-(2-nitrophenyl)prop-2-enamide.
| Compound Name | N-[(2,5-difluorophenyl)methyl]-3-(2-nitrophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 72687855 |
| Molecular Formula | C16H12F2N2O3 |
| Molecular Weight | 318.28 g/mol |
| Exact Mass | 318.08 |
| IUPAC Name | N-[(2,5-difluorophenyl)methyl]-3-(2-nitrophenyl)prop-2-enamide |
| SMILES | O=C(C=Cc1ccccc1[N+](=O)[O-])NCc1cc(F)ccc1F |
| InChI | InChI=1S/C16H12F2N2O3/c17-13-6-7-14(18)12(9-13)10-19-16(21)8-5-11-3-1-2-4-15(11)20(22)23/h1-9H,10H2,(H,19,21) |
| InChIKey | DAFNYGGQCDOUEX-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.28 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|