C24H23NO2 — CID 72688372
1-[4-(4-hydroxypiperidin-1-yl)phenyl]-3-naphthalen-2-ylprop-2-en-1-one (PubChem CID 72688372) has the molecular formula C24H23NO2 and a molecular weight of 357.45 g/mol. Its IUPAC name is 1-[4-(4-hydroxypiperidin-1-yl)phenyl]-3-naphthalen-2-ylprop-2-en-1-one.
| Compound Name | 1-[4-(4-hydroxypiperidin-1-yl)phenyl]-3-naphthalen-2-ylprop-2-en-1-one |
|---|---|
| PubChem CID | 72688372 |
| Molecular Formula | C24H23NO2 |
| Molecular Weight | 357.45 g/mol |
| Exact Mass | 357.17 |
| IUPAC Name | 1-[4-(4-hydroxypiperidin-1-yl)phenyl]-3-naphthalen-2-ylprop-2-en-1-one |
| SMILES | O=C(C=Cc1ccc2ccccc2c1)c1ccc(N2CCC(O)CC2)cc1 |
| InChI | InChI=1S/C24H23NO2/c26-23-13-15-25(16-14-23)22-10-8-20(9-11-22)24(27)12-6-18-5-7-19-3-1-2-4-21(19)17-18/h1-12,17,23,26H,13-16H2 |
| InChIKey | RGEXMZKVDPPNJA-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.45 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|