C25H31NO3 — CID 72692966
1-[4-(4-hydroxypiperidin-1-yl)phenyl]-3-[4-(3-methylbutoxy)phenyl]prop-2-en-1-one (PubChem CID 72692966) has the molecular formula C25H31NO3 and a molecular weight of 393.53 g/mol. Its IUPAC name is 1-[4-(4-hydroxypiperidin-1-yl)phenyl]-3-[4-(3-methylbutoxy)phenyl]prop-2-en-1-one.
| Compound Name | 1-[4-(4-hydroxypiperidin-1-yl)phenyl]-3-[4-(3-methylbutoxy)phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 72692966 |
| Molecular Formula | C25H31NO3 |
| Molecular Weight | 393.53 g/mol |
| Exact Mass | 393.23 |
| IUPAC Name | 1-[4-(4-hydroxypiperidin-1-yl)phenyl]-3-[4-(3-methylbutoxy)phenyl]prop-2-en-1-one |
| SMILES | CC(C)CCOc1ccc(C=CC(=O)c2ccc(N3CCC(O)CC3)cc2)cc1 |
| InChI | InChI=1S/C25H31NO3/c1-19(2)15-18-29-24-10-3-20(4-11-24)5-12-25(28)21-6-8-22(9-7-21)26-16-13-23(27)14-17-26/h3-12,19,23,27H,13-18H2,1-2H3 |
| InChIKey | UCZYDXHPQOOKKV-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.53 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|