C30H30N2O3 — CID 123195161
1-[4-[4-[(4-methoxyphenyl)methyl]piperazin-1-yl]phenyl]-3-(4-prop-2-ynoxyphenyl)prop-2-en-1-one (PubChem CID 123195161) has the molecular formula C30H30N2O3 and a molecular weight of 466.58 g/mol. Its IUPAC name is 1-[4-[4-[(4-methoxyphenyl)methyl]piperazin-1-yl]phenyl]-3-(4-prop-2-ynoxyphenyl)prop-2-en-1-one.
| Compound Name | 1-[4-[4-[(4-methoxyphenyl)methyl]piperazin-1-yl]phenyl]-3-(4-prop-2-ynoxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 123195161 |
| Molecular Formula | C30H30N2O3 |
| Molecular Weight | 466.58 g/mol |
| Exact Mass | 466.23 |
| IUPAC Name | 1-[4-[4-[(4-methoxyphenyl)methyl]piperazin-1-yl]phenyl]-3-(4-prop-2-ynoxyphenyl)prop-2-en-1-one |
| SMILES | C#CCOc1ccc(C=CC(=O)c2ccc(N3CCN(Cc4ccc(OC)cc4)CC3)cc2)cc1 |
| InChI | InChI=1S/C30H30N2O3/c1-3-22-35-29-15-4-24(5-16-29)8-17-30(33)26-9-11-27(12-10-26)32-20-18-31(19-21-32)23-25-6-13-28(34-2)14-7-25/h1,4-17H,18-23H2,2H3 |
| InChIKey | NAFUHUCTSYDUOX-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.58 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|