C17H17NO5 — CID 72688914
[4-(ethoxycarbonylamino)phenyl] 3-(5-methylfuran-2-yl)prop-2-enoate (PubChem CID 72688914) has the molecular formula C17H17NO5 and a molecular weight of 315.33 g/mol. Its IUPAC name is [4-(ethoxycarbonylamino)phenyl] 3-(5-methylfuran-2-yl)prop-2-enoate.
| Compound Name | [4-(ethoxycarbonylamino)phenyl] 3-(5-methylfuran-2-yl)prop-2-enoate |
|---|---|
| PubChem CID | 72688914 |
| Molecular Formula | C17H17NO5 |
| Molecular Weight | 315.33 g/mol |
| Exact Mass | 315.11 |
| IUPAC Name | [4-(ethoxycarbonylamino)phenyl] 3-(5-methylfuran-2-yl)prop-2-enoate |
| SMILES | CCOC(=O)Nc1ccc(OC(=O)C=Cc2ccc(C)o2)cc1 |
| InChI | InChI=1S/C17H17NO5/c1-3-21-17(20)18-13-5-8-15(9-6-13)23-16(19)11-10-14-7-4-12(2)22-14/h4-11H,3H2,1-2H3,(H,18,20) |
| InChIKey | MLESPXFCLIAQBA-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 77.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.33 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|