C17H14F2O2S — CID 72689037
3-(2,3-difluorophenyl)-1-(3-methoxy-4-methylsulfanylphenyl)prop-2-en-1-one (PubChem CID 72689037) has the molecular formula C17H14F2O2S and a molecular weight of 320.36 g/mol. Its IUPAC name is 3-(2,3-difluorophenyl)-1-(3-methoxy-4-methylsulfanylphenyl)prop-2-en-1-one.
| Compound Name | 3-(2,3-difluorophenyl)-1-(3-methoxy-4-methylsulfanylphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 72689037 |
| Molecular Formula | C17H14F2O2S |
| Molecular Weight | 320.36 g/mol |
| Exact Mass | 320.07 |
| IUPAC Name | 3-(2,3-difluorophenyl)-1-(3-methoxy-4-methylsulfanylphenyl)prop-2-en-1-one |
| SMILES | COc1cc(C(=O)C=Cc2cccc(F)c2F)ccc1SC |
| InChI | InChI=1S/C17H14F2O2S/c1-21-15-10-12(7-9-16(15)22-2)14(20)8-6-11-4-3-5-13(18)17(11)19/h3-10H,1-2H3 |
| InChIKey | OTILEXYVADMYBB-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.36 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|