C23H27NO5S — CID 146634837
2-[4-[(E)-3-[3-ethoxy-2-(propylamino)phenyl]prop-2-enoyl]-2-methoxyphenyl]sulfanylacetic acid (PubChem CID 146634837) has the molecular formula C23H27NO5S and a molecular weight of 429.54 g/mol. Its IUPAC name is 2-[4-[(E)-3-[3-ethoxy-2-(propylamino)phenyl]prop-2-enoyl]-2-methoxyphenyl]sulfanylacetic acid.
| Compound Name | 2-[4-[(E)-3-[3-ethoxy-2-(propylamino)phenyl]prop-2-enoyl]-2-methoxyphenyl]sulfanylacetic acid |
|---|---|
| PubChem CID | 146634837 |
| Molecular Formula | C23H27NO5S |
| Molecular Weight | 429.54 g/mol |
| Exact Mass | 429.16 |
| IUPAC Name | 2-[4-[(E)-3-[3-ethoxy-2-(propylamino)phenyl]prop-2-enoyl]-2-methoxyphenyl]sulfanylacetic acid |
| SMILES | CCCNc1c(/C=C/C(=O)c2ccc(SCC(=O)O)c(OC)c2)cccc1OCC |
| InChI | InChI=1S/C23H27NO5S/c1-4-13-24-23-16(7-6-8-19(23)29-5-2)9-11-18(25)17-10-12-21(20(14-17)28-3)30-15-22(26)27/h6-12,14,24H,4-5,13,15H2,1-3H3,(H,26,27)/b11-9+ |
| InChIKey | NPWXFTIJDOEZNN-PKNBQFBNSA-N |
| XLogP | 4.99 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.54 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|