C23H28N2O3 — CID 72689503
3-(4-acetamidophenyl)-N-ethyl-N-[1-(4-methoxyphenyl)propan-2-yl]prop-2-enamide (PubChem CID 72689503) has the molecular formula C23H28N2O3 and a molecular weight of 380.49 g/mol. Its IUPAC name is 3-(4-acetamidophenyl)-N-ethyl-N-[1-(4-methoxyphenyl)propan-2-yl]prop-2-enamide.
| Compound Name | 3-(4-acetamidophenyl)-N-ethyl-N-[1-(4-methoxyphenyl)propan-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 72689503 |
| Molecular Formula | C23H28N2O3 |
| Molecular Weight | 380.49 g/mol |
| Exact Mass | 380.21 |
| IUPAC Name | 3-(4-acetamidophenyl)-N-ethyl-N-[1-(4-methoxyphenyl)propan-2-yl]prop-2-enamide |
| SMILES | CCN(C(=O)C=Cc1ccc(NC(C)=O)cc1)C(C)Cc1ccc(OC)cc1 |
| InChI | InChI=1S/C23H28N2O3/c1-5-25(17(2)16-20-8-13-22(28-4)14-9-20)23(27)15-10-19-6-11-21(12-7-19)24-18(3)26/h6-15,17H,5,16H2,1-4H3,(H,24,26) |
| InChIKey | UPIRDBIYSHBKIU-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.49 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|