C23H28N5O2+ — CID 7269035
N-cyclopentyl-6-(cyclopentylamino)-13-methyl-2-oxo-1,7-diaza-9-azoniatricyclo[8.4.0.03,8]tetradeca-3,5,7,9,11,13-hexaene-5-carboxamide (PubChem CID 7269035) has the molecular formula C23H28N5O2+ and a molecular weight of 406.51 g/mol. Its IUPAC name is N-cyclopentyl-6-(cyclopentylamino)-13-methyl-2-oxo-1,7-diaza-9-azoniatricyclo[8.4.0.03,8]tetradeca-3,5,7,9,11,13-hexaene-5-carboxamide.
| Compound Name | N-cyclopentyl-6-(cyclopentylamino)-13-methyl-2-oxo-1,7-diaza-9-azoniatricyclo[8.4.0.03,8]tetradeca-3,5,7,9,11,13-hexaene-5-carboxamide |
|---|---|
| PubChem CID | 7269035 |
| Molecular Formula | C23H28N5O2+ |
| Molecular Weight | 406.51 g/mol |
| Exact Mass | 406.22 |
| IUPAC Name | N-cyclopentyl-6-(cyclopentylamino)-13-methyl-2-oxo-1,7-diaza-9-azoniatricyclo[8.4.0.03,8]tetradeca-3,5,7,9,11,13-hexaene-5-carboxamide |
| SMILES | Cc1ccc2[nH+]c3nc(NC4CCCC4)c(C(=O)NC4CCCC4)cc3c(=O)n2c1 |
| InChI | InChI=1S/C23H27N5O2/c1-14-10-11-19-26-21-18(23(30)28(19)13-14)12-17(22(29)25-16-8-4-5-9-16)20(27-21)24-15-6-2-3-7-15/h10-13,15-16H,2-9H2,1H3,(H,24,27)(H,25,29)/p+1 |
| InChIKey | YBGAFRSMCXFMNI-UHFFFAOYSA-O |
| XLogP | 3.00 |
| TPSA | 89.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.51 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|