C24H30N6O2 — CID 72692107
2-[[amino-[6-(3,5-dimethylpyrazol-1-yl)-3-pyridinyl]methylidene]amino]oxy-N-(4-tert-butylphenyl)propanamide (PubChem CID 72692107) has the molecular formula C24H30N6O2 and a molecular weight of 434.54 g/mol. Its IUPAC name is 2-[[amino-[6-(3,5-dimethylpyrazol-1-yl)-3-pyridinyl]methylidene]amino]oxy-N-(4-tert-butylphenyl)propanamide.
| Compound Name | 2-[[amino-[6-(3,5-dimethylpyrazol-1-yl)-3-pyridinyl]methylidene]amino]oxy-N-(4-tert-butylphenyl)propanamide |
|---|---|
| PubChem CID | 72692107 |
| Molecular Formula | C24H30N6O2 |
| Molecular Weight | 434.54 g/mol |
| Exact Mass | 434.24 |
| IUPAC Name | 2-[[amino-[6-(3,5-dimethylpyrazol-1-yl)-3-pyridinyl]methylidene]amino]oxy-N-(4-tert-butylphenyl)propanamide |
| SMILES | Cc1cc(C)n(-c2ccc(C(N)=NOC(C)C(=O)Nc3ccc(C(C)(C)C)cc3)cn2)n1 |
| InChI | InChI=1S/C24H30N6O2/c1-15-13-16(2)30(28-15)21-12-7-18(14-26-21)22(25)29-32-17(3)23(31)27-20-10-8-19(9-11-20)24(4,5)6/h7-14,17H,1-6H3,(H2,25,29)(H,27,31) |
| InChIKey | LAGWOPQCUYFHEI-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 107.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.54 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|