C25H22N2O5S2 — CID 72696154
2-hydroxy-5-[3-[(Z)-[3-[(3-methoxyphenyl)methyl]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-2,5-dimethylpyrrol-1-yl]benzoic acid (PubChem CID 72696154) has the molecular formula C25H22N2O5S2 and a molecular weight of 494.59 g/mol. Its IUPAC name is 2-hydroxy-5-[3-[(Z)-[3-[(3-methoxyphenyl)methyl]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-2,5-dimethylpyrrol-1-yl]benzoic acid.
| Compound Name | 2-hydroxy-5-[3-[(Z)-[3-[(3-methoxyphenyl)methyl]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-2,5-dimethylpyrrol-1-yl]benzoic acid |
|---|---|
| PubChem CID | 72696154 |
| Molecular Formula | C25H22N2O5S2 |
| Molecular Weight | 494.59 g/mol |
| Exact Mass | 494.10 |
| IUPAC Name | 2-hydroxy-5-[3-[(Z)-[3-[(3-methoxyphenyl)methyl]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-2,5-dimethylpyrrol-1-yl]benzoic acid |
| SMILES | COc1cccc(CN2C(=O)/C(=C/c3cc(C)n(-c4ccc(O)c(C(=O)O)c4)c3C)SC2=S)c1 |
| InChI | InChI=1S/C25H22N2O5S2/c1-14-9-17(15(2)27(14)18-7-8-21(28)20(12-18)24(30)31)11-22-23(29)26(25(33)34-22)13-16-5-4-6-19(10-16)32-3/h4-12,28H,13H2,1-3H3,(H,30,31)/b22-11- |
| InChIKey | BFGCQAUUYKDDHP-JJFYIABZSA-N |
| XLogP | 4.91 |
| TPSA | 92.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.59 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|