C15H14N4O3S — CID 72700693
6-[[4-amino-5-(2-methylphenyl)-1,2,4-triazol-3-yl]sulfanylmethyl]pyran-3,4-dione (PubChem CID 72700693) has the molecular formula C15H14N4O3S and a molecular weight of 330.37 g/mol. Its IUPAC name is 6-[[4-amino-5-(2-methylphenyl)-1,2,4-triazol-3-yl]sulfanylmethyl]pyran-3,4-dione.
| Compound Name | 6-[[4-amino-5-(2-methylphenyl)-1,2,4-triazol-3-yl]sulfanylmethyl]pyran-3,4-dione |
|---|---|
| PubChem CID | 72700693 |
| Molecular Formula | C15H14N4O3S |
| Molecular Weight | 330.37 g/mol |
| Exact Mass | 330.08 |
| IUPAC Name | 6-[[4-amino-5-(2-methylphenyl)-1,2,4-triazol-3-yl]sulfanylmethyl]pyran-3,4-dione |
| SMILES | Cc1ccccc1-c1nnc(SCC2=CC(=O)C(=O)CO2)n1N |
| InChI | InChI=1S/C15H14N4O3S/c1-9-4-2-3-5-11(9)14-17-18-15(19(14)16)23-8-10-6-12(20)13(21)7-22-10/h2-6H,7-8,16H2,1H3 |
| InChIKey | KIOXORNVWCDXIB-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 100.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.37 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|