C14H29NO5 — CID 72702304
(2R,3S,4S,5R)-2-[(2R)-3-hexoxy-2-hydroxypropyl]piperidine-3,4,5-triol (PubChem CID 72702304) has the molecular formula C14H29NO5 and a molecular weight of 291.39 g/mol. Its IUPAC name is (2R,3S,4S,5R)-2-[(2R)-3-hexoxy-2-hydroxypropyl]piperidine-3,4,5-triol.
| Compound Name | (2R,3S,4S,5R)-2-[(2R)-3-hexoxy-2-hydroxypropyl]piperidine-3,4,5-triol |
|---|---|
| PubChem CID | 72702304 |
| Molecular Formula | C14H29NO5 |
| Molecular Weight | 291.39 g/mol |
| Exact Mass | 291.20 |
| IUPAC Name | (2R,3S,4S,5R)-2-[(2R)-3-hexoxy-2-hydroxypropyl]piperidine-3,4,5-triol |
| SMILES | CCCCCCOC[C@H](O)C[C@H]1NC[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C14H29NO5/c1-2-3-4-5-6-20-9-10(16)7-11-13(18)14(19)12(17)8-15-11/h10-19H,2-9H2,1H3/t10-,11-,12-,13+,14+/m1/s1 |
| InChIKey | SDFIGJSZLOODKO-POQQGIQPSA-N |
| XLogP | -0.61 |
| TPSA | 102.18 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.39 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|