C27H26ClN3 — CID 72703063
7-chloro-N-(4-phenylphenyl)-1-(2-pyrrolidin-1-ylethyl)quinolin-4-imine (PubChem CID 72703063) has the molecular formula C27H26ClN3 and a molecular weight of 427.98 g/mol. Its IUPAC name is 7-chloro-N-(4-phenylphenyl)-1-(2-pyrrolidin-1-ylethyl)quinolin-4-imine.
| Compound Name | 7-chloro-N-(4-phenylphenyl)-1-(2-pyrrolidin-1-ylethyl)quinolin-4-imine |
|---|---|
| PubChem CID | 72703063 |
| Molecular Formula | C27H26ClN3 |
| Molecular Weight | 427.98 g/mol |
| Exact Mass | 427.18 |
| IUPAC Name | 7-chloro-N-(4-phenylphenyl)-1-(2-pyrrolidin-1-ylethyl)quinolin-4-imine |
| SMILES | Clc1ccc2/c(=N/c3ccc(-c4ccccc4)cc3)ccn(CCN3CCCC3)c2c1 |
| InChI | InChI=1S/C27H26ClN3/c28-23-10-13-25-26(14-17-31(27(25)20-23)19-18-30-15-4-5-16-30)29-24-11-8-22(9-12-24)21-6-2-1-3-7-21/h1-3,6-14,17,20H,4-5,15-16,18-19H2/b29-26+ |
| InChIKey | FFGZMENTXSUMBI-PBBVDAKRSA-N |
| XLogP | 6.29 |
| TPSA | 20.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.98 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |