C27H26F3N3O2 — CID 72706944
4-cyclopropyl-9-[(2,3,6-trifluoro-4-quinolin-7-ylphenyl)methyl]-1-oxa-4,9-diazaspiro[5.5]undecan-3-one (PubChem CID 72706944) has the molecular formula C27H26F3N3O2 and a molecular weight of 481.52 g/mol. Its IUPAC name is 4-cyclopropyl-9-[(2,3,6-trifluoro-4-quinolin-7-ylphenyl)methyl]-1-oxa-4,9-diazaspiro[5.5]undecan-3-one.
| Compound Name | 4-cyclopropyl-9-[(2,3,6-trifluoro-4-quinolin-7-ylphenyl)methyl]-1-oxa-4,9-diazaspiro[5.5]undecan-3-one |
|---|---|
| PubChem CID | 72706944 |
| Molecular Formula | C27H26F3N3O2 |
| Molecular Weight | 481.52 g/mol |
| Exact Mass | 481.20 |
| IUPAC Name | 4-cyclopropyl-9-[(2,3,6-trifluoro-4-quinolin-7-ylphenyl)methyl]-1-oxa-4,9-diazaspiro[5.5]undecan-3-one |
| SMILES | O=C1COC2(CCN(Cc3c(F)cc(-c4ccc5cccnc5c4)c(F)c3F)CC2)CN1C1CC1 |
| InChI | InChI=1S/C27H26F3N3O2/c28-22-13-20(18-4-3-17-2-1-9-31-23(17)12-18)25(29)26(30)21(22)14-32-10-7-27(8-11-32)16-33(19-5-6-19)24(34)15-35-27/h1-4,9,12-13,19H,5-8,10-11,14-16H2 |
| InChIKey | YYTUNPHFHGOYKQ-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.52 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|