C28H27F6N3O4 — CID 72720579
4-cyclopropyl-9-[[2,3,6-trifluoro-4-(1H-indol-6-yl)phenyl]methyl]-1-oxa-4,9-diazaspiro[5.5]undecan-3-one;2,2,2-trifluoroacetic acid (PubChem CID 72720579) has the molecular formula C28H27F6N3O4 and a molecular weight of 583.53 g/mol. Its IUPAC name is 4-cyclopropyl-9-[[2,3,6-trifluoro-4-(1H-indol-6-yl)phenyl]methyl]-1-oxa-4,9-diazaspiro[5.5]undecan-3-one;2,2,2-trifluoroacetic acid.
| Compound Name | 4-cyclopropyl-9-[[2,3,6-trifluoro-4-(1H-indol-6-yl)phenyl]methyl]-1-oxa-4,9-diazaspiro[5.5]undecan-3-one;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 72720579 |
| Molecular Formula | C28H27F6N3O4 |
| Molecular Weight | 583.53 g/mol |
| Exact Mass | 583.19 |
| IUPAC Name | 4-cyclopropyl-9-[[2,3,6-trifluoro-4-(1H-indol-6-yl)phenyl]methyl]-1-oxa-4,9-diazaspiro[5.5]undecan-3-one;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.O=C1COC2(CCN(Cc3c(F)cc(-c4ccc5cc[nH]c5c4)c(F)c3F)CC2)CN1C1CC1 |
| InChI | InChI=1S/C26H26F3N3O2.C2HF3O2/c27-21-12-19(17-2-1-16-5-8-30-22(16)11-17)24(28)25(29)20(21)13-31-9-6-26(7-10-31)15-32(18-3-4-18)23(33)14-34-26;3-2(4,5)1(6)7/h1-2,5,8,11-12,18,30H,3-4,6-7,9-10,13-15H2;(H,6,7) |
| InChIKey | DCIMEJBJYAFELP-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 85.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.53 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|